EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N4O2 |
| Net Charge | 0 |
| Average Mass | 374.444 |
| Monoisotopic Mass | 374.17428 |
| SMILES | CC(C)OC(=O)N[C@H]1Cc2c(n(Cc3ccccn3)c3ccc(C#N)cc23)C1 |
| InChI | InChI=1S/C22H22N4O2/c1-14(2)28-22(27)25-17-10-19-18-9-15(12-23)6-7-20(18)26(21(19)11-17)13-16-5-3-4-8-24-16/h3-9,14,17H,10-11,13H2,1-2H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | IHIWYQYVBNODSV-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ly2452473 (CHEBI:755365) has role antineoplastic agent (CHEBI:35610) |
| ly2452473 (CHEBI:755365) has role vasodilator agent (CHEBI:35620) |
| ly2452473 (CHEBI:755365) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| LY-2452473 | ChEMBL |
| LY2452473 | ChEMBL |
| OPK-88004 | ChEMBL |
| TT-701 | ChEMBL |
| Citations |
|---|