EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36N2O6 |
| Net Charge | 0 |
| Average Mass | 424.538 |
| Monoisotopic Mass | 424.25734 |
| SMILES | [H][C@]1([C@@]2(C)O[C@@H]2CC=C(C)C)[C@H](OC)[C@H](OC(=O)N[C@@H](C(N)=O)C(C)C)CC[C@]12CO2 |
| InChI | InChI=1S/C22H36N2O6/c1-12(2)7-8-15-21(5,30-15)18-17(27-6)14(9-10-22(18)11-28-22)29-20(26)24-16(13(3)4)19(23)25/h7,13-18H,8-11H2,1-6H3,(H2,23,25)(H,24,26)/t14-,15-,16-,17-,18-,21+,22+/m1/s1 |
| InChIKey | QBDVVYNLLXGUGN-XGTBZJOHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ppi-2458 (CHEBI:755364) has role antineoplastic agent (CHEBI:35610) |
| ppi-2458 (CHEBI:755364) is a valine derivative (CHEBI:27267) |
| Synonym | Source |
|---|---|
| Ppi-2458 | ChEMBL |
| Citations |
|---|