EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19N3O3 |
| Net Charge | 0 |
| Average Mass | 349.390 |
| Monoisotopic Mass | 349.14264 |
| SMILES | O=c1nnc2c3c(cccc13)Oc1ccc(CN3CCC(O)CC3)cc1-2 |
| InChI | InChI=1S/C20H19N3O3/c24-13-6-8-23(9-7-13)11-12-4-5-16-15(10-12)19-18-14(20(25)22-21-19)2-1-3-17(18)26-16/h1-5,10,13,24H,6-9,11H2,(H,22,25) |
| InChIKey | HAVFFEMDLROBGI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| e-7016 (CHEBI:755363) has role antineoplastic agent (CHEBI:35610) |
| e-7016 (CHEBI:755363) is a xanthenes (CHEBI:38835) |
| Synonyms | Source |
|---|---|
| E 7016 | ChEMBL |
| E-7016 | ChEMBL |
| E7016 | ChEMBL |
| GPI-21016 | ChEMBL |
| Citations |
|---|