EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6BrN3O5 |
| Net Charge | 0 |
| Average Mass | 268.023 |
| Monoisotopic Mass | 266.94908 |
| SMILES | O=C(CBr)N1CC([N+](=O)[O-])([N+](=O)[O-])C1 |
| InChI | InChI=1S/C5H6BrN3O5/c6-1-4(10)7-2-5(3-7,8(11)12)9(13)14/h1-3H2 |
| InChIKey | JODKFOVZURLVTG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nibrozetone (CHEBI:755362) has role anti-inflammatory agent (CHEBI:67079) |
| nibrozetone (CHEBI:755362) has role antineoplastic agent (CHEBI:35610) |
| nibrozetone (CHEBI:755362) is a carboxamide (CHEBI:37622) |
| INNs | Source |
|---|---|
| nibrozetona | WHO MedNet |
| nibrozetone | WHO MedNet |
| Synonyms | Source |
|---|---|
| Abdnaz | ChEMBL |
| Radiosensitizer rrx-001 | ChEMBL |
| Rrx 001 | ChEMBL |
| Rrx-001 | ChEMBL |
| Citations |
|---|