EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40FN4O14P |
| Net Charge | 0 |
| Average Mass | 706.614 |
| Monoisotopic Mass | 706.22627 |
| SMILES | O=C(O)CC[C@H](NP(=O)(O)OCCC[C@H](NC(=O)CC[C@H](NC(=O)CCCCCNC(=O)c1ccc(F)cc1)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C28H40FN4O14P/c29-18-9-7-17(8-10-18)25(38)30-15-3-1-2-6-22(34)32-20(27(41)42)11-13-23(35)31-19(26(39)40)5-4-16-47-48(45,46)33-21(28(43)44)12-14-24(36)37/h7-10,19-21H,1-6,11-16H2,(H,30,38)(H,31,35)(H,32,34)(H,36,37)(H,39,40)(H,41,42)(H,43,44)(H2,33,45,46)/t19-,20-,21-/m0/s1 |
| InChIKey | IZLOSIXADNUSCM-ACRUOGEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ctt-1057 (CHEBI:755360) has role antineoplastic agent (CHEBI:35610) |
| ctt-1057 (CHEBI:755360) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| Ctt-1057 | ChEMBL |
| CTT1057 | ChEMBL |
| Citations |
|---|