EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 450.406 |
| Monoisotopic Mass | 449.15245 |
| SMILES | C[C@H]1c2cccc(CCC(C)(C)O)c2C[C@H](CO)N1C(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H29Cl2NO3/c1-15-18-7-4-6-16(10-11-24(2,3)30)19(18)12-17(14-28)27(15)23(29)13-20-21(25)8-5-9-22(20)26/h4-9,15,17,28,30H,10-14H2,1-3H3/t15-,17+/m0/s1 |
| InChIKey | XHCSBQBBGNQINS-DOTOQJQBSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mevidalen (CHEBI:755357) has role antiparkinson drug (CHEBI:48407) |
| mevidalen (CHEBI:755357) is a isoquinolines (CHEBI:24922) |
| INN | Source |
|---|---|
| mevidalen | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY-3154207 | ChEMBL |
| LY3154207 | ChEMBL |
| Citations |
|---|