EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25ClFN3O6 |
| Net Charge | 0 |
| Average Mass | 433.864 |
| Monoisotopic Mass | 433.14159 |
| SMILES | CC(C)C(=O)OC[C@@]1(CCl)O[C@@H](n2ccc(N)nc2=O)[C@H](F)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C18H25ClFN3O6/c1-9(2)15(24)27-8-18(7-19)13(28-16(25)10(3)4)12(20)14(29-18)23-6-5-11(21)22-17(23)26/h5-6,9-10,12-14H,7-8H2,1-4H3,(H2,21,22,26)/t12-,13+,14-,18-/m1/s1 |
| InChIKey | MJVKYGMNSQJLIN-KYZVSKTDSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lumicitabine (CHEBI:755356) has role antiviral agent (CHEBI:22587) |
| lumicitabine (CHEBI:755356) is a deoxyribonucleoside (CHEBI:23636) |
| INNs | Source |
|---|---|
| lumicitabina | WHO MedNet |
| lumicitabine | WHO MedNet |
| Synonyms | Source |
|---|---|
| ALS-008176 | ChEMBL |
| Als-8176 | ChEMBL |
| Citations |
|---|