EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30ClN7O3S |
| Net Charge | 0 |
| Average Mass | 532.070 |
| Monoisotopic Mass | 531.18194 |
| SMILES | Cc1cn2nc([C@@H]3CCCCN3C(=O)c3cc(Cl)ccc3NS(C)(=O)=O)cc2nc1N1CC[C@H](N)C1 |
| InChI | InChI=1S/C24H30ClN7O3S/c1-15-13-32-22(27-23(15)30-10-8-17(26)14-30)12-20(28-32)21-5-3-4-9-31(21)24(33)18-11-16(25)6-7-19(18)29-36(2,34)35/h6-7,11-13,17,21,29H,3-5,8-10,14,26H2,1-2H3/t17-,21-/m0/s1 |
| InChIKey | GOFXWTVKPWJNGD-UWJYYQICSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| presatovir (CHEBI:755353) has role antiviral agent (CHEBI:22587) |
| presatovir (CHEBI:755353) is a N-acylpiperidine (CHEBI:48591) |
| INN | Source |
|---|---|
| presatovir | WHO MedNet |
| Synonym | Source |
|---|---|
| GS-5806 | ChEMBL |
| Citations |
|---|