EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H34N4O3 |
| Net Charge | 0 |
| Average Mass | 534.660 |
| Monoisotopic Mass | 534.26309 |
| SMILES | COc1ccc2c(c1)[C@]1(C[C@H]1c1ccc3c(/C=C/c4ccc(CN5C[C@@H](C)O[C@@H](C)C5)cc4)nnc3c1)C(=O)N2 |
| InChI | InChI=1S/C33H34N4O3/c1-20-17-37(18-21(2)40-20)19-23-6-4-22(5-7-23)8-12-29-26-11-9-24(14-31(26)36-35-29)28-16-33(28)27-15-25(39-3)10-13-30(27)34-32(33)38/h4-15,20-21,28H,16-19H2,1-3H3,(H,34,38)(H,35,36)/b12-8+/t20-,21+,28-,33-/m0/s1 |
| InChIKey | DADASRPKWOGKCU-FVTQAUBDSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ocifisertib (CHEBI:755352) has role antineoplastic agent (CHEBI:35610) |
| ocifisertib (CHEBI:755352) is a indazoles (CHEBI:38769) |
| INN | Source |
|---|---|
| ocifisertib | WHO MedNet |
| Synonym | Source |
|---|---|
| Cfi-400945 free base | ChEMBL |
| Citations |
|---|