EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C30H37N3O7S |
| Net Charge | 0 |
| Average Mass | 620.168 |
| Monoisotopic Mass | 619.21190 |
| SMILES | COc1c(NC(=O)C(=O)c2ccc(OCCN3CCOCC3)c3ccccc23)cc(C(C)(C)C)cc1NS(C)(=O)=O.Cl |
| InChI | InChI=1S/C30H37N3O7S.ClH/c1-30(2,3)20-18-24(28(38-4)25(19-20)32-41(5,36)37)31-29(35)27(34)23-10-11-26(22-9-7-6-8-21(22)23)40-17-14-33-12-15-39-16-13-33;/h6-11,18-19,32H,12-17H2,1-5H3,(H,31,35);1H |
| InChIKey | ICIJBYYMEBOTQP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| itx-5061 (CHEBI:755349) has role antiviral agent (CHEBI:22587) |
| itx-5061 (CHEBI:755349) is a naphthalenes (CHEBI:25477) |
| Synonyms | Source |
|---|---|
| Itx-5061 | ChEMBL |
| ITX 5061 | ChEMBL |
| KC-706 | ChEMBL |
| KC706 | ChEMBL |
| Citations |
|---|