EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N8O |
| Net Charge | 0 |
| Average Mass | 354.418 |
| Monoisotopic Mass | 354.19166 |
| SMILES | Cc1nc2c(-c3cnc(N)nc3)nc(N3CCOCC3)nc2n1C(C)C |
| InChI | InChI=1S/C17H22N8O/c1-10(2)25-11(3)21-14-13(12-8-19-16(18)20-9-12)22-17(23-15(14)25)24-4-6-26-7-5-24/h8-10H,4-7H2,1-3H3,(H2,18,19,20) |
| InChIKey | QYBGBLQCOOISAR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vs-5584 (CHEBI:755348) has role antineoplastic agent (CHEBI:35610) |
| vs-5584 (CHEBI:755348) is a purines (CHEBI:26401) |
| Synonyms | Source |
|---|---|
| Vs 5584 | ChEMBL |
| Vs-5584 | ChEMBL |
| Citations |
|---|