EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H15ClN4O2 |
| Net Charge | 0 |
| Average Mass | 390.830 |
| Monoisotopic Mass | 390.08835 |
| SMILES | O=C(c1cccnc1)N1CCN2C(=O)c3ccncc3[C@]12c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15ClN4O2/c22-16-5-3-15(4-6-16)21-18-13-24-9-7-17(18)20(28)26(21)11-10-25(21)19(27)14-2-1-8-23-12-14/h1-9,12-13H,10-11H2/t21-/m1/s1 |
| InChIKey | QZSZPSDRJPPZDZ-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bta-9881 (CHEBI:755347) has role antiviral agent (CHEBI:22587) |
| bta-9881 (CHEBI:755347) is a imidazolidines (CHEBI:38261) |
| Synonyms | Source |
|---|---|
| AZD-9639 | ChEMBL |
| Bta-9881 | ChEMBL |
| BTA9881 | ChEMBL |
| Medi 564 | ChEMBL |
| Citations |
|---|