EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H21NO5S |
| Net Charge | 0 |
| Average Mass | 471.534 |
| Monoisotopic Mass | 471.11404 |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(-c3c(O)ccc4ccccc34)c(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H21NO5S/c1-33-18-11-13-19(14-12-18)34(31,32)28-24-16-23(27(30)22-9-5-4-8-21(22)24)26-20-7-3-2-6-17(20)10-15-25(26)29/h2-16,28-30H,1H3 |
| InChIKey | QDCJDYWGYVPBDO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| c-188-9 (CHEBI:755346) has role antifibrotic agent (CHEBI:233423) |
| c-188-9 (CHEBI:755346) has role antineoplastic agent (CHEBI:35610) |
| c-188-9 (CHEBI:755346) is a naphthols (CHEBI:25392) |
| Synonyms | Source |
|---|---|
| C-188-9 | ChEMBL |
| Stat3 inhibitor c188-9 | ChEMBL |
| Stat3 inhibitor tti-101 | ChEMBL |
| Tti 101 | ChEMBL |
| TTI-101 | ChEMBL |
| TTI101 | ChEMBL |
| Citations |
|---|