EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H29ClN2O3S |
| Net Charge | 0 |
| Average Mass | 509.071 |
| Monoisotopic Mass | 508.15874 |
| SMILES | CC(C)(O)c1cn(-c2ccc(-c3cccc(S(C)(=O)=O)c3)cc2)c(C(C)(C)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C28H29ClN2O3S/c1-27(2,23-11-6-7-12-24(23)29)26-30-25(28(3,4)32)18-31(26)21-15-13-19(14-16-21)20-9-8-10-22(17-20)35(5,33)34/h6-18,32H,1-5H3 |
| InChIKey | JLPURTXCSILYLW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-779788 (CHEBI:755345) has role antiatherosclerotic agent (CHEBI:145947) |
| bms-779788 (CHEBI:755345) is a imidazoles (CHEBI:24780) |
| Synonyms | Source |
|---|---|
| Bms-779788 | ChEMBL |
| BMS 788 | ChEMBL |
| EXEL 04286652 | ChEMBL |
| EXEL-04286652 | ChEMBL |
| XL-014 | ChEMBL |
| XL 652 | ChEMBL |
| Citations |
|---|