EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H25ClN6O4S |
| Net Charge | 0 |
| Average Mass | 541.033 |
| Monoisotopic Mass | 540.13465 |
| SMILES | COc1ccc(Cl)c(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccc(NC(=O)C(C)(C)N)c2)c1 |
| InChI | InChI=1S/C25H25ClN6O4S/c1-25(2,27)24(33)28-15-7-6-8-17(13-15)37(34,35)32-23-22(29-19-9-4-5-10-20(19)30-23)31-21-14-16(36-3)11-12-18(21)26/h4-14H,27H2,1-3H3,(H,28,33)(H,29,31)(H,30,32) |
| InChIKey | QINPEPAQOBZPOF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pilaralisib (CHEBI:755344) has role antineoplastic agent (CHEBI:35610) |
| pilaralisib (CHEBI:755344) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| pilaralisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| SAR-245408 | ChEMBL |
| SAR245408 | ChEMBL |
| XL147 | ChEMBL |
| Citations |
|---|