EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21F4N3O4 |
| Net Charge | 0 |
| Average Mass | 467.419 |
| Monoisotopic Mass | 467.14682 |
| SMILES | CCOc1cc(=O)ncc1-c1ccc(CC(=O)Nc2cc(C(C)(C)C(F)(F)F)on2)c(F)c1 |
| InChI | InChI=1S/C22H21F4N3O4/c1-4-32-16-9-19(30)27-11-14(16)12-5-6-13(15(23)7-12)8-20(31)28-18-10-17(33-29-18)21(2,3)22(24,25)26/h5-7,9-11H,4,8H2,1-3H3,(H,27,30)(H,28,29,31) |
| InChIKey | IDXKJSSOUXWLDB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-3179106 (CHEBI:755339) has role antispasmodic drug (CHEBI:53784) |
| gsk-3179106 (CHEBI:755339) is a acetamides (CHEBI:22160) |
| Synonyms | Source |
|---|---|
| Gsk3179106 | ChEMBL |
| GSK-3179106 | ChEMBL |
| Citations |
|---|