EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H25ClN2O4S |
| Net Charge | 0 |
| Average Mass | 485.005 |
| Monoisotopic Mass | 484.12236 |
| SMILES | C[C@]1(C(=O)N(CCCC(=O)O)Cc2cccc(Cl)c2)CCN1C(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C25H25ClN2O4S/c1-25(11-13-28(25)23(31)20-16-33-21-9-3-2-8-19(20)21)24(32)27(12-5-10-22(29)30)15-17-6-4-7-18(26)14-17/h2-4,6-9,14,16H,5,10-13,15H2,1H3,(H,29,30)/t25-/m1/s1 |
| InChIKey | MPMKMQHJHDHPBE-RUZDIDTESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glpg-0974 (CHEBI:755336) has role anti-inflammatory agent (CHEBI:67079) |
| glpg-0974 (CHEBI:755336) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| GLPG-0974 | ChEMBL |
| GLPG0974 | ChEMBL |
| Citations |
|---|