EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12F3N |
| Net Charge | 0 |
| Average Mass | 227.229 |
| Monoisotopic Mass | 227.09218 |
| SMILES | [H][C@]12CNC[C@]([H])(C1)c1ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C12H12F3N/c13-12(14,15)9-1-2-10-7-3-8(6-16-5-7)11(10)4-9/h1-2,4,7-8,16H,3,5-6H2/t7-,8+/m0/s1 |
| InChIKey | RNOBTWYQAWEZHH-JGVFFNPUSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cp-601927 (CHEBI:755331) has role antidepressant (CHEBI:35469) |
| cp-601927 (CHEBI:755331) is a benzazepine (CHEBI:35676) |
| Synonyms | Source |
|---|---|
| Cp-601927 | ChEMBL |
| CP-601,927 | ChEMBL |
| Citations |
|---|