EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:755328 - emoxypine
| Formula | C8H11NO |
| Net Charge | 0 |
| Average Mass | 137.182 |
| Monoisotopic Mass | 137.08406 |
| SMILES | CCc1nc(C)ccc1O |
| InChI | InChI=1S/C8H11NO/c1-3-7-8(10)5-4-6(2)9-7/h4-5,10H,3H2,1-2H3 |
| InChIKey | JPGDYIGSCHWQCC-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emoxypine (CHEBI:755328) is a chloropyridine (CHEBI:39173) |
| Synonyms | Source |
|---|---|
| Emoxipin | ChEMBL |
| Emoxipine | ChEMBL |
| Emoxypin | ChEMBL |
| Epigid | ChEMBL |
| Epygid | ChEMBL |
| Ethylmethylhydroxypyridine | ChEMBL |
| Citations |
|---|