EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25ClN2O |
| Net Charge | 0 |
| Average Mass | 344.886 |
| Monoisotopic Mass | 344.16554 |
| SMILES | CCCCn1ccc(N2CCC(c3ccccc3)CC2)c(Cl)c1=O |
| InChI | InChI=1S/C20H25ClN2O/c1-2-3-12-23-15-11-18(19(21)20(23)24)22-13-9-17(10-14-22)16-7-5-4-6-8-16/h4-8,11,15,17H,2-3,9-10,12-14H2,1H3 |
| InChIKey | HYOGJHCDLQSAHX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jnj-40411813 (CHEBI:755326) has role anticonvulsant (CHEBI:35623) |
| jnj-40411813 (CHEBI:755326) has role antidepressant (CHEBI:35469) |
| jnj-40411813 (CHEBI:755326) has role antipsychotic agent (CHEBI:35476) |
| jnj-40411813 (CHEBI:755326) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| ADX-71149 | ChEMBL |
| Jnj-40411813 | ChEMBL |
| Citations |
|---|