EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23F3N4O3S |
| Net Charge | 0 |
| Average Mass | 456.490 |
| Monoisotopic Mass | 456.14430 |
| SMILES | O=c1nc(N2CCN(CC3CCCCC3)CC2)sc2c([N+](=O)[O-])cc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C20H23F3N4O3S/c21-20(22,23)14-10-15-17(16(11-14)27(29)30)31-19(24-18(15)28)26-8-6-25(7-9-26)12-13-4-2-1-3-5-13/h10-11,13H,1-9,12H2 |
| InChIKey | BJDZBXGJNBMCAV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| macozinone (CHEBI:755322) has role antitubercular agent (CHEBI:33231) |
| macozinone (CHEBI:755322) is a N-arylpiperazine (CHEBI:46848) |
| INNs | Source |
|---|---|
| macozinona | WHO MedNet |
| macozinone | WHO MedNet |
| Synonyms | Source |
|---|---|
| PBTZ-169 | ChEMBL |
| PBTZ169 | ChEMBL |
| Citations |
|---|