EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H37N7O5S |
| Net Charge | 0 |
| Average Mass | 595.726 |
| Monoisotopic Mass | 595.25769 |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](CNc2nc(C)nc(N3CCC(c4ccc5c(n4)NCCC5)CC3)c2C)C(=O)O)cc1 |
| InChI | InChI=1S/C29H37N7O5S/c1-18-26(31-17-25(29(37)38)35-42(39,40)23-9-7-22(41-3)8-10-23)32-19(2)33-28(18)36-15-12-20(13-16-36)24-11-6-21-5-4-14-30-27(21)34-24/h6-11,20,25,35H,4-5,12-17H2,1-3H3,(H,30,34)(H,37,38)(H,31,32,33)/t25-/m0/s1 |
| InChIKey | CXHCNOMGODVIKB-VWLOTQADSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glpg-0187 (CHEBI:755320) has role antineoplastic agent (CHEBI:35610) |
| glpg-0187 (CHEBI:755320) is a naphthyridine derivative (CHEBI:73539) |
| Synonyms | Source |
|---|---|
| Glpg-0187 | ChEMBL |
| GLPG0187 | ChEMBL |
| Citations |
|---|