EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19F2N5O2 |
| Net Charge | 0 |
| Average Mass | 399.401 |
| Monoisotopic Mass | 399.15068 |
| SMILES | O=C(O)[C@H]1C2CCC(CC2)[C@@H]1Nc1nc(-c2cnc3ncc(F)cc23)ncc1F |
| InChI | InChI=1S/C20H19F2N5O2/c21-11-5-12-13(7-24-17(12)23-6-11)18-25-8-14(22)19(27-18)26-16-10-3-1-9(2-4-10)15(16)20(28)29/h5-10,15-16H,1-4H2,(H,23,24)(H,28,29)(H,25,26,27)/t9?,10?,15-,16-/m0/s1 |
| InChIKey | JGPXDNKSIXAZEQ-SBBZOCNPSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimodivir (CHEBI:755319) has functional parent β-amino acid (CHEBI:33706) |
| pimodivir (CHEBI:755319) has role antiviral agent (CHEBI:22587) |
| pimodivir (CHEBI:755319) has role renoprotective agent (CHEBI:231911) |
| pimodivir (CHEBI:755319) is a organonitrogen compound (CHEBI:35352) |
| pimodivir (CHEBI:755319) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| pimodivir | WHO MedNet |
| Synonyms | Source |
|---|---|
| JNJ-63623872 | ChEMBL |
| JNJ63623872 | ChEMBL |
| JNJ-63623872-ZCD | ChEMBL |
| JNJ - 63623872 - ZCD | ChEMBL |
| JNJ-872 | ChEMBL |
| JNJ872 | ChEMBL |
| Citations |
|---|