EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755318 - vaborbactam
| Formula | C12H16BNO5S |
| Net Charge | 0 |
| Average Mass | 297.141 |
| Monoisotopic Mass | 297.08422 |
| SMILES | O=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2cccs2)B(O)O1 |
| InChI | InChI=1S/C12H16BNO5S/c15-11(7-9-2-1-5-20-9)14-10-4-3-8(6-12(16)17)19-13(10)18/h1-2,5,8,10,18H,3-4,6-7H2,(H,14,15)(H,16,17)/t8-,10-/m0/s1 |
| InChIKey | IOOWNWLVCOUUEX-WPRPVWTQSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vaborbactam (CHEBI:755318) has role antibacterial agent (CHEBI:33282) |
| vaborbactam (CHEBI:755318) has role antiinfective agent (CHEBI:35441) |
| vaborbactam (CHEBI:755318) is a organoboron compound (CHEBI:38278) |
| Synonyms | Source |
|---|---|
| RPX-7009 | ChEMBL |
| RPX7009 | ChEMBL |
| Vaborbactam | ChEMBL |
| Brand Names | Source |
|---|---|
| Vaborbactam component of carbavance | ChEMBL |
| Vaborbactam component of vabomere | ChEMBL |
| Citations |
|---|