EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28FN3O |
| Net Charge | 0 |
| Average Mass | 393.506 |
| Monoisotopic Mass | 393.22164 |
| SMILES | [H][C@@]12CN(CCCC(=O)c3ccc(F)cc3)CC[C@]1([H])N1CCN(C)c3cccc2c31 |
| InChI | InChI=1S/C24H28FN3O/c1-26-14-15-28-21-11-13-27(16-20(21)19-4-2-5-22(26)24(19)28)12-3-6-23(29)17-7-9-18(25)10-8-17/h2,4-5,7-10,20-21H,3,6,11-16H2,1H3/t20-,21-/m0/s1 |
| InChIKey | HOIIHACBCFLJET-SFTDATJTSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lumateperone (CHEBI:755315) has role antidepressant (CHEBI:35469) |
| lumateperone (CHEBI:755315) has role antipsychotic agent (CHEBI:35476) |
| lumateperone (CHEBI:755315) is a aromatic ketone (CHEBI:76224) |
| INN | Source |
|---|---|
| lumateperona | WHO MedNet |
| Synonyms | Source |
|---|---|
| ITI 007 | ChEMBL |
| ITI-007 | ChEMBL |
| ITI007 | ChEMBL |
| ITI-722 | ChEMBL |
| Lumateperone | ChEMBL |
| Citations |
|---|