EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23ClF2N4O2S |
| Net Charge | 0 |
| Average Mass | 480.968 |
| Monoisotopic Mass | 480.11983 |
| SMILES | Cc1nn(-c2ncccc2CO)cc1CN1CCC2(CC1)OCC(F)(F)c1cc(Cl)sc12 |
| InChI | InChI=1S/C22H23ClF2N4O2S/c1-14-16(11-29(27-14)20-15(12-30)3-2-6-26-20)10-28-7-4-21(5-8-28)19-17(9-18(23)32-19)22(24,25)13-31-21/h2-3,6,9,11,30H,4-5,7-8,10,12-13H2,1H3 |
| InChIKey | NKQHBJNRBKHUQR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ly-2940094 (CHEBI:755311) has role antidepressant (CHEBI:35469) |
| ly-2940094 (CHEBI:755311) has role antiparkinson drug (CHEBI:48407) |
| ly-2940094 (CHEBI:755311) is a pyrazolopyridine (CHEBI:46699) |
| Synonyms | Source |
|---|---|
| BTRX-246040 | ChEMBL |
| J3.309.394B | ChEMBL |
| Ly-2940094 | ChEMBL |