EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4O2.C59H79N15O21S6 |
| Net Charge | 0 |
| Average Mass | 1586.819 |
| Monoisotopic Mass | 1585.41105 |
| SMILES | CC(=O)O.[H][C@@]12CCCN1C(=O)[C@H](CC(N)=O)NC(=O)[C@]1([H])CSSC[C@H](N)C(=O)N[C@@]3([H])CSSC[C@]([H])(NC(=O)[C@H](C)NC2=O)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)NCC(=O)N[C@H](C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)O)CSSC[C@]([H])(NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](CCC(=O)O)NC3=O)C(=O)N1 |
| InChI | InChI=1S/C59H79N15O21S6.C2H4O2/c1-26-47(82)69-41-25-101-99-22-38-52(87)65-33(13-14-45(80)81)49(84)66-34(16-28-5-9-30(76)10-6-28)50(85)71-40(54(89)72-39(23-97-96-20-32(60)48(83)70-38)53(88)67-35(18-43(61)78)58(93)74-15-3-4-42(74)56(91)63-26)24-100-98-21-37(64-44(79)19-62-57(92)46(27(2)75)73-55(41)90)51(86)68-36(59(94)95)17-29-7-11-31(77)12-8-29;1-2(3)4/h5-12,26-27,32-42,46,75-77H,3-4,13-25,60H2,1-2H3,(H2,61,78)(H,62,92)(H,63,91)(H,64,79)(H,65,87)(H,66,84)(H,67,88)(H,68,86)(H,69,82)(H,70,83)(H,71,85)(H,72,89)(H,73,90)(H,80,81)(H,94,95);1H3,(H,3,4)/t26-,27+,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,46-;/m0./s1 |
| InChIKey | KWFNVZFWXXEJKL-YZDVLOIKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linaclotide acetate (CHEBI:755309) has role antineoplastic agent (CHEBI:35610) |
| linaclotide acetate (CHEBI:755309) has role antispasmodic drug (CHEBI:53784) |
| linaclotide acetate (CHEBI:755309) has role laxative (CHEBI:50503) |
| linaclotide acetate (CHEBI:755309) is a polypeptide (CHEBI:15841) |
| Synonym | Source |
|---|---|
| MM-416775 | ChEMBL |