EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C50H66Cl4N8O10S2.HCl |
| Net Charge | 0 |
| Average Mass | 1217.992 |
| Monoisotopic Mass | 1214.26310 |
| SMILES | Cl.Cl.[H][C@@]1(c2cccc(S(=O)(=O)NCCOCCOCCNC(=O)NCCCCNC(=O)NCCOCCOCCNS(=O)(=O)c3cccc([C@]4([H])CN(C)Cc5c(Cl)cc(Cl)cc54)c3)c2)CN(C)Cc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C50H66Cl4N8O10S2.2ClH/c1-61-31-43(41-27-37(51)29-47(53)45(41)33-61)35-7-5-9-39(25-35)73(65,66)59-15-19-71-23-21-69-17-13-57-49(63)55-11-3-4-12-56-50(64)58-14-18-70-22-24-72-20-16-60-74(67,68)40-10-6-8-36(26-40)44-32-62(2)34-46-42(44)28-38(52)30-48(46)54;;/h5-10,25-30,43-44,59-60H,3-4,11-24,31-34H2,1-2H3,(H2,55,57,63)(H2,56,58,64);2*1H/t43-,44-;;/m0../s1 |
| InChIKey | VFRAXTZDILCRKY-OWRGXFNZSA-N |
| Roles Classification |
|---|
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenapanor hydrochloride (CHEBI:755304) has role antispasmodic drug (CHEBI:53784) |
| tenapanor hydrochloride (CHEBI:755304) has role laxative (CHEBI:50503) |
| tenapanor hydrochloride (CHEBI:755304) is a isoquinolines (CHEBI:24922) |
| Synonyms | Source |
|---|---|
| AZD1722 | ChEMBL |
| AZD1722 hydrochloride | ChEMBL |
| AZD-1722 HYDROCHLORIDE | ChEMBL |
| RDX-5791 | ChEMBL |
| RDX5791 | ChEMBL |
| Tenapanor dihydrochloride | ChEMBL |
| Brand Name | Source |
|---|---|
| Ibsrela | ChEMBL |