EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13ClFN3 |
| Net Charge | 0 |
| Average Mass | 325.774 |
| Monoisotopic Mass | 325.07820 |
| SMILES | Cc1nc(C#Cc2ccnc(Cl)c2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H13ClFN3/c1-12-17(8-3-14-9-10-21-18(19)11-14)22-13(2)23(12)16-6-4-15(20)5-7-16/h4-7,9-11H,1-2H3 |
| InChIKey | UPZWINBEAHDTLA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| basimglurant (CHEBI:755303) has role antidepressant (CHEBI:35469) |
| basimglurant (CHEBI:755303) is a imidazoles (CHEBI:24780) |
| INN | Source |
|---|---|
| basimglurant | WHO MedNet |
| Synonyms | Source |
|---|---|
| NOE-101 | ChEMBL |
| Rg7090 | ChEMBL |
| RG-7090 | ChEMBL |
| RO-4917523 | ChEMBL |
| RO4917523 | ChEMBL |
| RO4917523-000 | ChEMBL |
| Citations |
|---|