EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22FN5O3 |
| Net Charge | 0 |
| Average Mass | 423.448 |
| Monoisotopic Mass | 423.17067 |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(OCCOC)cc3)ncc2F)c1 |
| InChI | InChI=1S/C22H22FN5O3/c1-3-20(29)25-16-5-4-6-17(13-16)26-21-19(23)14-24-22(28-21)27-15-7-9-18(10-8-15)31-12-11-30-2/h3-10,13-14H,1,11-12H2,2H3,(H,25,29)(H2,24,26,27,28) |
| InChIKey | KXBDTLQSDKGAEB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spebrutinib (CHEBI:755302) has role antineoplastic agent (CHEBI:35610) |
| spebrutinib (CHEBI:755302) is a anilide (CHEBI:13248) |
| INN | Source |
|---|---|
| espebrutinib | WHO MedNet |
| Synonym | Source |
|---|---|
| Btk inhibitor cc-292 | ChEMBL |
| Citations |
|---|