EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H68N18O9S2 |
| Net Charge | 0 |
| Average Mass | 1117.334 |
| Monoisotopic Mass | 1116.48581 |
| SMILES | CC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H]1CSSC[C@@H](C(N)=O)NC(=O)[C@H](Cc2cnc3ccccc23)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2cncn2)NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C49H68N18O9S2/c1-26-41(70)63-37(20-30-22-55-25-59-30)46(75)64-35(18-28-10-4-3-5-11-28)44(73)62-34(15-9-17-57-49(53)54)43(72)65-36(19-29-21-58-32-13-7-6-12-31(29)32)45(74)66-38(40(50)69)23-77-78-24-39(47(76)60-26)67-42(71)33(61-27(2)68)14-8-16-56-48(51)52/h3-7,10-13,21-22,25-26,33-39,58H,8-9,14-20,23-24H2,1-2H3,(H2,50,69)(H,55,59)(H,60,76)(H,61,68)(H,62,73)(H,63,70)(H,64,75)(H,65,72)(H,66,74)(H,67,71)(H4,51,52,56)(H4,53,54,57)/t26-,33+,34+,35-,36+,37+,38+,39+/m1/s1 |
| InChIKey | HDHDTKMUACZDAA-PHNIDTBTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| setmelanotide (CHEBI:755301) has role anti-obesity agent (CHEBI:74518) |
| setmelanotide (CHEBI:755301) is a polypeptide (CHEBI:15841) |
| INN | Source |
|---|---|
| setmelanotida | WHO MedNet |
| Synonyms | Source |
|---|---|
| BIM-22493 | ChEMBL |
| RM-493 | ChEMBL |
| Setmelanotide | ChEMBL |
| Brand Name | Source |
|---|---|
| Imcivree | ChEMBL |
| Citations |
|---|