EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23N7O4 |
| Net Charge | 0 |
| Average Mass | 473.493 |
| Monoisotopic Mass | 473.18115 |
| SMILES | COc1cnc(-n2cnc(C)n2)c2ncc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3)c12 |
| InChI | InChI=1S/C24H23N7O4/c1-15-27-14-31(28-15)22-20-19(18(35-2)13-26-22)17(12-25-20)21(32)24(34)30-10-8-29(9-11-30)23(33)16-6-4-3-5-7-16/h3-7,12-14,25H,8-11H2,1-2H3 |
| InChIKey | QRPZBKAMSFHVRW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| temsavir (CHEBI:755300) has role anti-HIV agent (CHEBI:64946) |
| temsavir (CHEBI:755300) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| temsavir | WHO MedNet |
| Synonym | Source |
|---|---|
| BMS-626529 | ChEMBL |
| Citations |
|---|