EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34N4O2 |
| Net Charge | 0 |
| Average Mass | 458.606 |
| Monoisotopic Mass | 458.26818 |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(-c3ccc(C(=O)N4CCCC4)cc3)cc2N=C(N)C1 |
| InChI | InChI=1S/C28H34N4O2/c1-3-13-31(14-4-2)28(34)24-17-23-12-11-22(18-25(23)30-26(29)19-24)20-7-9-21(10-8-20)27(33)32-15-5-6-16-32/h7-12,17-18H,3-6,13-16,19H2,1-2H3,(H2,29,30) |
| InChIKey | QSPOQCXMGPDIHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| motolimod (CHEBI:755299) has role antineoplastic agent (CHEBI:35610) |
| motolimod (CHEBI:755299) is a benzazepine (CHEBI:35676) |
| INN | Source |
|---|---|
| motolimod | WHO MedNet |
| Synonyms | Source |
|---|---|
| VTX-2337 | ChEMBL |
| VTX-378 | ChEMBL |
| Citations |
|---|