EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O4 |
| Net Charge | 0 |
| Average Mass | 274.401 |
| Monoisotopic Mass | 274.21441 |
| SMILES | CCCCCCCCCCCC(=O)OC[C@@H](O)CO |
| InChI | InChI=1S/C15H30O4/c1-2-3-4-5-6-7-8-9-10-11-15(18)19-13-14(17)12-16/h14,16-17H,2-13H2,1H3/t14-/m0/s1 |
| InChIKey | ARIWANIATODDMH-AWEZNQCLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-lauroyl-sn-glycerol (CHEBI:75529) is a 1-acyl-sn-glycerol (CHEBI:64683) |
| 1-lauroyl-sn-glycerol (CHEBI:75529) is a 1-monolauroylglycerol (CHEBI:75539) |
| 1-lauroyl-sn-glycerol (CHEBI:75529) is enantiomer of 3-lauroyl-sn-glycerol (CHEBI:75528) |
| Incoming Relation(s) |
| rac-1-monolauroylglycerol (CHEBI:75543) has part 1-lauroyl-sn-glycerol (CHEBI:75529) |
| 3-lauroyl-sn-glycerol (CHEBI:75528) is enantiomer of 1-lauroyl-sn-glycerol (CHEBI:75529) |
| IUPAC Name |
|---|
| (2S)-2,3-dihydroxypropyl dodecanoate |
| Synonyms | Source |
|---|---|
| [(2S)-2,3-bis(oxidanyl)propyl] dodecanoate | ChEBI |
| (2S)-2,3-dihydroxypropyl laurate | IUPAC |
| MG (12:0/0:0/0:0) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 1-dodecanoyl-sn-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C13854 | KEGG COMPOUND |
| LMGL01010008 | LIPID MAPS |