EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755288 - relebactam
| Formula | C12H20N4O6S.H2O |
| Net Charge | 0 |
| Average Mass | 366.396 |
| Monoisotopic Mass | 366.12092 |
| SMILES | O.[H][C@@]12CC[C@@H](C(=O)NC3CCNCC3)N(C1)C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H20N4O6S.H2O/c17-11(14-8-3-5-13-6-4-8)10-2-1-9-7-15(10)12(18)16(9)22-23(19,20)21;/h8-10,13H,1-7H2,(H,14,17)(H,19,20,21);1H2/t9-,10+;/m1./s1 |
| InChIKey | TWFRCSHLWKJBQH-UXQCFNEQSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| relebactam (CHEBI:755288) has role antibacterial agent (CHEBI:33282) |
| relebactam (CHEBI:755288) has role antiinfective agent (CHEBI:35441) |
| relebactam (CHEBI:755288) has role antineoplastic agent (CHEBI:35610) |
| relebactam (CHEBI:755288) is a amino acid amide (CHEBI:22475) |
| Synonyms | Source |
|---|---|
| MK-7655 MONOHYDRATE | ChEMBL |
| Relebactam | ChEMBL |
| Relebactam hydrate | ChEMBL |
| (-)-relebactam monohydrate | ChEMBL |
| Relebactam monohydrate | ChEMBL |
| Brand Names | Source |
|---|---|
| Relebactam component of mk-7655a | ChEMBL |
| Relebactam component of recarbrio | ChEMBL |
| Relebactam component of recarbrio monohydrate | ChEMBL |
| Citations |
|---|