EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26ClNO5 |
| Net Charge | 0 |
| Average Mass | 431.916 |
| Monoisotopic Mass | 431.14995 |
| SMILES | O=C(O)COC[C@H]1CC[C@H](COC(=O)N(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H26ClNO5/c24-19-10-12-21(13-11-19)25(20-4-2-1-3-5-20)23(28)30-15-18-8-6-17(7-9-18)14-29-16-22(26)27/h1-5,10-13,17-18H,6-9,14-16H2,(H,26,27)/t17-,18- |
| InChIKey | NPDKXVKJRHPDQT-IYARVYRRSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ralinepag (CHEBI:755287) has role antihypertensive agent (CHEBI:35674) |
| ralinepag (CHEBI:755287) is a carbamate ester (CHEBI:23003) |
| INN | Source |
|---|---|
| ralinepag | WHO MedNet |
| Synonyms | Source |
|---|---|
| APD-811 | ChEMBL |
| APD811 | ChEMBL |
| Citations |
|---|