EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15Cl2N |
| Net Charge | 0 |
| Average Mass | 292.209 |
| Monoisotopic Mass | 291.05815 |
| SMILES | N[C@@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C16H15Cl2N/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13/h1-5,7,9,11,16H,6,8,19H2/t11-,16+/m0/s1 |
| InChIKey | SRPXSILJHWNFMK-MEDUHNTESA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dasotraline (CHEBI:755278) has role antidepressant (CHEBI:35469) |
| dasotraline (CHEBI:755278) is a tetralins (CHEBI:36786) |
| INNs | Source |
|---|---|
| dasotralina | WHO MedNet |
| dasotraline | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1r,4s)-trans-norsertraline | ChEMBL |
| Norsertraline, (1r,4s)-trans- | ChEMBL |
| SEP-225289 | ChEMBL |
| Citations |
|---|