EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26N7O8P |
| Net Charge | 0 |
| Average Mass | 583.498 |
| Monoisotopic Mass | 583.15805 |
| SMILES | COc1cnc(-n2cnc(C)n2)c2c1c(C(=O)C(=O)N1CCN(C(=O)c3ccccc3)CC1)cn2COP(=O)(O)O |
| InChI | InChI=1S/C25H26N7O8P/c1-16-27-14-32(28-16)23-21-20(19(39-2)12-26-23)18(13-31(21)15-40-41(36,37)38)22(33)25(35)30-10-8-29(9-11-30)24(34)17-6-4-3-5-7-17/h3-7,12-14H,8-11,15H2,1-2H3,(H2,36,37,38) |
| InChIKey | SWMDAPWAQQTBOG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fostemsavir (CHEBI:755277) has role anti-HIV agent (CHEBI:64946) |
| fostemsavir (CHEBI:755277) has role antiviral agent (CHEBI:22587) |
| fostemsavir (CHEBI:755277) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| BMS-663068 | ChEMBL |
| Bms-663068 free acid | ChEMBL |
| Fostemsavir | ChEMBL |
| Citations |
|---|