EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755253 - telacebec
| Formula | C29H28ClF3N4O2 |
| Net Charge | 0 |
| Average Mass | 557.016 |
| Monoisotopic Mass | 556.18529 |
| SMILES | CCc1nc2ccc(Cl)cn2c1C(=O)NCc1ccc(N2CCC(c3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H28ClF3N4O2/c1-2-25-27(37-18-22(30)7-12-26(37)35-25)28(38)34-17-19-3-8-23(9-4-19)36-15-13-21(14-16-36)20-5-10-24(11-6-20)39-29(31,32)33/h3-12,18,21H,2,13-17H2,1H3,(H,34,38) |
| InChIKey | OJICYBSWSZGRFB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telacebec (CHEBI:755253) has role anti-ulcer drug (CHEBI:49201) |
| telacebec (CHEBI:755253) has role antitubercular agent (CHEBI:33231) |
| telacebec (CHEBI:755253) has role antiviral agent (CHEBI:22587) |
| telacebec (CHEBI:755253) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| telacebec | WHO MedNet |
| Synonyms | Source |
|---|---|
| Q-203 | ChEMBL |
| Q203 | ChEMBL |
| Citations |
|---|