EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755251 - contezolid
| Formula | C18H15F3N4O4 |
| Net Charge | 0 |
| Average Mass | 408.336 |
| Monoisotopic Mass | 408.10454 |
| SMILES | O=C1C=CN(c2c(F)cc(N3C[C@H](CNc4ccon4)OC3=O)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H15F3N4O4/c19-12-7-13(15(20)16(21)17(12)24-4-1-10(26)2-5-24)25-9-11(29-18(25)27)8-22-14-3-6-28-23-14/h1,3-4,6-7,11H,2,5,8-9H2,(H,22,23)/t11-/m0/s1 |
| InChIKey | SULYVXZZUMRQAX-NSHDSACASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| contezolid (CHEBI:755251) has role antibacterial agent (CHEBI:33282) |
| contezolid (CHEBI:755251) has role antitubercular agent (CHEBI:33231) |
| contezolid (CHEBI:755251) is a tertiary amine (CHEBI:32876) |
| INN | Source |
|---|---|
| contezolid | WHO MedNet |
| Synonyms | Source |
|---|---|
| MRX-1 | ChEMBL |
| MRX-I | ChEMBL |
| Citations |
|---|