EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N4O3S2 |
| Net Charge | 0 |
| Average Mass | 366.468 |
| Monoisotopic Mass | 366.08203 |
| SMILES | O=C(CCCCNC(=O)c1nc(-c2nccs2)sc1C1CC1)NO |
| InChI | InChI=1S/C15H18N4O3S2/c20-10(19-22)3-1-2-6-16-13(21)11-12(9-4-5-9)24-15(18-11)14-17-7-8-23-14/h7-9,22H,1-6H2,(H,16,21)(H,19,20) |
| InChIKey | MVJAEZIEZVJAFM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisthianostat (CHEBI:755250) has role antineoplastic agent (CHEBI:35610) |
| bisthianostat (CHEBI:755250) is a aromatic amide (CHEBI:62733) |
| bisthianostat (CHEBI:755250) is a thiazoles (CHEBI:48901) |
| Synonym | Source |
|---|---|
| Bisthianostat | ChEMBL |
| Citations |
|---|