EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19F5N2O |
| Net Charge | 0 |
| Average Mass | 398.375 |
| Monoisotopic Mass | 398.14175 |
| SMILES | Fc1ccc2c(CCNCc3cccc(OCC(F)(F)C(F)F)c3)cnc2c1 |
| InChI | InChI=1S/C20H19F5N2O/c21-15-4-5-17-14(11-27-18(17)9-15)6-7-26-10-13-2-1-3-16(8-13)28-12-20(24,25)19(22)23/h1-5,8-9,11,19,26-27H,6-7,10,12H2 |
| InChIKey | YBAWYTYNMZWMMJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| idalopirdine (CHEBI:755247) has role antipsychotic agent (CHEBI:35476) |
| idalopirdine (CHEBI:755247) is a indoles (CHEBI:24828) |
| INNs | Source |
|---|---|
| idalopirdina | WHO MedNet |
| idalopirdine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Lu AE58054 | ChEMBL |
| LU AE-58054 | ChEMBL |
| LU-AE-58054 | ChEMBL |
| LU-AE58054 | ChEMBL |
| LY-483518 | ChEMBL |
| LY483518 | ChEMBL |
| Citations |
|---|