EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18FN7 |
| Net Charge | 0 |
| Average Mass | 399.433 |
| Monoisotopic Mass | 399.16077 |
| SMILES | Cc1cccc(-c2nc(CNc3ccccc3F)nc2-c2ccc3ncnn3c2)n1 |
| InChI | InChI=1S/C22H18FN7/c1-14-5-4-8-18(27-14)22-21(15-9-10-20-25-13-26-30(20)12-15)28-19(29-22)11-24-17-7-3-2-6-16(17)23/h2-10,12-13,24H,11H2,1H3,(H,28,29) |
| InChIKey | FJCDSQATIJKQKA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vactosertib (CHEBI:755241) has role antineoplastic agent (CHEBI:35610) |
| vactosertib (CHEBI:755241) is a triazolopyridine (CHEBI:46746) |
| INN | Source |
|---|---|
| vactosertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ew-7197 | ChEMBL |
| Tew 7197 | ChEMBL |
| TEW-7197 | ChEMBL |
| Citations |
|---|