EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H26N2O4 |
| Net Charge | 0 |
| Average Mass | 442.515 |
| Monoisotopic Mass | 442.18926 |
| SMILES | Cc1nc2ccccc2c(-c2ccc3c4c(ccnc24)CCO3)c1[C@H](OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C27H26N2O4/c1-15-21(25(26(30)31)33-27(2,3)4)23(17-7-5-6-8-19(17)29-15)18-9-10-20-22-16(12-14-32-20)11-13-28-24(18)22/h5-11,13,25H,12,14H2,1-4H3,(H,30,31)/t25-/m0/s1 |
| InChIKey | MIXIIJCBELCMCZ-VWLOTQADSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bi-224436 (CHEBI:755239) has role anti-HIV agent (CHEBI:64946) |
| bi-224436 (CHEBI:755239) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Bi 224436 | ChEMBL |
| Bi-224436 | ChEMBL |
| Citations |
|---|