EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:755238 - tk-112690
| Formula | C10H12N2O5 |
| Net Charge | 0 |
| Average Mass | 240.215 |
| Monoisotopic Mass | 240.07462 |
| SMILES | [H][C@@]12Oc3nc(=O)c(C)cn3[C@]1([H])O[C@H](CO)[C@H]2O |
| InChI | InChI=1S/C10H12N2O5/c1-4-2-12-9-7(6(14)5(3-13)16-9)17-10(12)11-8(4)15/h2,5-7,9,13-14H,3H2,1H3/t5-,6-,7+,9-/m1/s1 |
| InChIKey | WLLOAUCNUMYOQI-JAGXHNFQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tk-112690 (CHEBI:755238) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| Synonyms | Source |
|---|---|
| O2,2'-anhydro-5-methyluridine | ChEMBL |
| TK-112690 | ChEMBL |
| Citations |
|---|