EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O3S |
| Net Charge | 0 |
| Average Mass | 283.313 |
| Monoisotopic Mass | 283.07391 |
| SMILES | Nc1nc(=S)c2ncn([C@H]3C[C@H](O)[C@@H](CO)O3)c2n1 |
| InChI | InChI=1S/C10H13N5O3S/c11-10-13-8-7(9(19)14-10)12-3-15(8)6-1-4(17)5(2-16)18-6/h3-6,16-17H,1-2H2,(H3,11,13,14,19)/t4-,5+,6+/m0/s1 |
| InChIKey | SCVJRXQHFJXZFZ-KVQBGUIXSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ateganosine (CHEBI:755237) has role antineoplastic agent (CHEBI:35610) |
| ateganosine (CHEBI:755237) is a purine 2'-deoxyribonucleoside (CHEBI:19254) |
| INNs | Source |
|---|---|
| ateganosina | WHO MedNet |
| ateganosine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2'-deoxy-6-thioguanosine | ChEMBL |
| 2'-deoxythioguanosine | ChEMBL |
| 2'-desoxy-6-thioguanosine | ChEMBL |
| 6-thio-2'-deoxyguanosine | ChEMBL |
| Beta-2'-deoxythioguanosine | ChEMBL |
| NSC-71261 | ChEMBL |
| Citations |
|---|