EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31NO10 |
| Net Charge | 0 |
| Average Mass | 529.542 |
| Monoisotopic Mass | 529.19480 |
| SMILES | [H][C@]1(O[C@H]2C[C@](O)(CCO)Cc3c(O)c4c(c(O)c32)C(=O)c2c(OC)cccc2C4=O)C[C@H](N)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C27H31NO10/c1-11-22(30)14(28)8-17(37-11)38-16-10-27(35,6-7-29)9-13-19(16)26(34)21-20(24(13)32)23(31)12-4-3-5-15(36-2)18(12)25(21)33/h3-5,11,14,16-17,22,29-30,32,34-35H,6-10,28H2,1-2H3/t11-,14-,16-,17-,22+,27-/m0/s1 |
| InChIKey | RGVRUQHYQSORBY-JIGXQNLBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-deoxydoxorubicin (CHEBI:755236) has role antineoplastic agent (CHEBI:35610) |
| 13-deoxydoxorubicin (CHEBI:755236) is a anthracycline (CHEBI:48120) |
| Synonyms | Source |
|---|---|
| 13-deoxydoxorubicin | ChEMBL |
| GPX-100 | ChEMBL |
| Citations |
|---|