EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N5 |
| Net Charge | 0 |
| Average Mass | 221.308 |
| Monoisotopic Mass | 221.16405 |
| SMILES | CC(C)c1cc(N2CC[C@@H](N)C2)nc(N)n1 |
| InChI | InChI=1S/C11H19N5/c1-7(2)9-5-10(15-11(13)14-9)16-4-3-8(12)6-16/h5,7-8H,3-4,6,12H2,1-2H3,(H2,13,14,15)/t8-/m1/s1 |
| InChIKey | COOGVHJHSCBOQT-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jnj-39758979 (CHEBI:755234) has role anti-asthmatic agent (CHEBI:65023) |
| jnj-39758979 (CHEBI:755234) has role antirheumatic drug (CHEBI:35842) |
| jnj-39758979 (CHEBI:755234) is a dialkylarylamine (CHEBI:23665) |
| jnj-39758979 (CHEBI:755234) is a tertiary amino compound (CHEBI:50996) |
| Synonyms | Source |
|---|---|
| Jnj 39758979 | ChEMBL |
| Jnj-39758979 | ChEMBL |
| JNJ-39758979, (-)- | ChEMBL |
| JNJ39758979 | ChEMBL |
| Citations |
|---|