EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H18ClN5O2S2 |
| Net Charge | 0 |
| Average Mass | 520.039 |
| Monoisotopic Mass | 519.05904 |
| SMILES | N#Cc1c(N)nc(SCc2csc(-c3ccc(Cl)cc3)n2)c(C#N)c1-c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C25H18ClN5O2S2/c26-17-5-1-16(2-6-17)24-30-18(13-34-24)14-35-25-21(12-28)22(20(11-27)23(29)31-25)15-3-7-19(8-4-15)33-10-9-32/h1-8,13,32H,9-10,14H2,(H2,29,31) |
| InChIKey | CITWCLNVRIKQAF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capadenoson (CHEBI:755233) has role anti-arrhythmia drug (CHEBI:38070) |
| capadenoson (CHEBI:755233) has role cardiovascular drug (CHEBI:35554) |
| capadenoson (CHEBI:755233) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| capadenoson | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bay-684986 | ChEMBL |
| BAY 68-4986 | ChEMBL |
| BAY-68-4986 | ChEMBL |
| Citations |
|---|