EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17F5N4 |
| Net Charge | 0 |
| Average Mass | 372.341 |
| Monoisotopic Mass | 372.13734 |
| SMILES | Fc1ccc(CN2CCC(Nc3ccc(C(F)(F)F)nn3)CC2)cc1F |
| InChI | InChI=1S/C17H17F5N4/c18-13-2-1-11(9-14(13)19)10-26-7-5-12(6-8-26)23-16-4-3-15(24-25-16)17(20,21)22/h1-4,9,12H,5-8,10H2,(H,23,25) |
| InChIKey | UVUYWJWYRLJHEN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jnj-37822681 (CHEBI:755231) has role antipsychotic agent (CHEBI:35476) |
| jnj-37822681 (CHEBI:755231) is a piperidines (CHEBI:26151) |
| Synonym | Source |
|---|---|
| JNJ-37822681 | ChEMBL |
| Citations |
|---|